C8H9BrN2O — CID 12983473
N-(2-bromoethyl)pyridine-2-carboxamide (PubChem CID 12983473) has the molecular formula C8H9BrN2O and a molecular weight of 229.08 g/mol. Its IUPAC name is N-(2-bromoethyl)pyridine-2-carboxamide.
| Compound Name | N-(2-bromoethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 12983473 |
| Molecular Formula | C8H9BrN2O |
| Molecular Weight | 229.08 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | N-(2-bromoethyl)pyridine-2-carboxamide |
| SMILES | O=C(NCCBr)c1ccccn1 |
| InChI | InChI=1S/C8H9BrN2O/c9-4-6-11-8(12)7-3-1-2-5-10-7/h1-3,5H,4,6H2,(H,11,12) |
| InChIKey | SMFVCKFWLXDJNS-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.08 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|