C13H19N3O3 — CID 47453309
tert-butyl N-[2-(pyridine-2-carbonylamino)ethyl]carbamate (PubChem CID 47453309) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is tert-butyl N-[2-(pyridine-2-carbonylamino)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(pyridine-2-carbonylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 47453309 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | tert-butyl N-[2-(pyridine-2-carbonylamino)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)c1ccccn1 |
| InChI | InChI=1S/C13H19N3O3/c1-13(2,3)19-12(18)16-9-8-15-11(17)10-6-4-5-7-14-10/h4-7H,8-9H2,1-3H3,(H,15,17)(H,16,18) |
| InChIKey | KEYCBSDIGVPEKL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|