C17H26N4O4 — CID 108921655
tert-butyl N-[3-oxo-3-[3-(pyridine-2-carbonylamino)propylamino]propyl]carbamate (PubChem CID 108921655) has the molecular formula C17H26N4O4 and a molecular weight of 350.42 g/mol. Its IUPAC name is tert-butyl N-[3-oxo-3-[3-(pyridine-2-carbonylamino)propylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-oxo-3-[3-(pyridine-2-carbonylamino)propylamino]propyl]carbamate |
|---|---|
| PubChem CID | 108921655 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | tert-butyl N-[3-oxo-3-[3-(pyridine-2-carbonylamino)propylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NCCCNC(=O)c1ccccn1 |
| InChI | InChI=1S/C17H26N4O4/c1-17(2,3)25-16(24)21-12-8-14(22)19-10-6-11-20-15(23)13-7-4-5-9-18-13/h4-5,7,9H,6,8,10-12H2,1-3H3,(H,19,22)(H,20,23)(H,21,24) |
| InChIKey | NJTSUFQPVLJQQJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|