C19H26F3N3O4 — CID 108921622
tert-butyl N-[3-oxo-3-[3-[[2-(trifluoromethyl)benzoyl]amino]propylamino]propyl]carbamate (PubChem CID 108921622) has the molecular formula C19H26F3N3O4 and a molecular weight of 417.43 g/mol. Its IUPAC name is tert-butyl N-[3-oxo-3-[3-[[2-(trifluoromethyl)benzoyl]amino]propylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-oxo-3-[3-[[2-(trifluoromethyl)benzoyl]amino]propylamino]propyl]carbamate |
|---|---|
| PubChem CID | 108921622 |
| Molecular Formula | C19H26F3N3O4 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | tert-butyl N-[3-oxo-3-[3-[[2-(trifluoromethyl)benzoyl]amino]propylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NCCCNC(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H26F3N3O4/c1-18(2,3)29-17(28)25-12-9-15(26)23-10-6-11-24-16(27)13-7-4-5-8-14(13)19(20,21)22/h4-5,7-8H,6,9-12H2,1-3H3,(H,23,26)(H,24,27)(H,25,28) |
| InChIKey | UXMNTMHPAAJPNK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|