C16H24N2O3S — CID 170912768
tert-butyl N-[4-[(2-sulfanylbenzoyl)amino]butyl]carbamate (PubChem CID 170912768) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is tert-butyl N-[4-[(2-sulfanylbenzoyl)amino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[(2-sulfanylbenzoyl)amino]butyl]carbamate |
|---|---|
| PubChem CID | 170912768 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | tert-butyl N-[4-[(2-sulfanylbenzoyl)amino]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCNC(=O)c1ccccc1S |
| InChI | InChI=1S/C16H24N2O3S/c1-16(2,3)21-15(20)18-11-7-6-10-17-14(19)12-8-4-5-9-13(12)22/h4-5,8-9,22H,6-7,10-11H2,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | ANCOVJLCQMJMDJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|