C19H29N3O4S — CID 88873514
tert-butyl N-[2-[[2-(butylcarbamoylsulfanyl)benzoyl]amino]ethyl]carbamate (PubChem CID 88873514) has the molecular formula C19H29N3O4S and a molecular weight of 395.53 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(butylcarbamoylsulfanyl)benzoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(butylcarbamoylsulfanyl)benzoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 88873514 |
| Molecular Formula | C19H29N3O4S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | tert-butyl N-[2-[[2-(butylcarbamoylsulfanyl)benzoyl]amino]ethyl]carbamate |
| SMILES | CCCCNC(=O)Sc1ccccc1C(=O)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H29N3O4S/c1-5-6-11-22-18(25)27-15-10-8-7-9-14(15)16(23)20-12-13-21-17(24)26-19(2,3)4/h7-10H,5-6,11-13H2,1-4H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | WDGMKIKGOQAGED-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|