C14H21N3O4S2 — CID 88873528
S-[2-(1-sulfamoylethylcarbamoyl)phenyl] N-butylcarbamothioate (PubChem CID 88873528) has the molecular formula C14H21N3O4S2 and a molecular weight of 359.47 g/mol. Its IUPAC name is S-[2-(1-sulfamoylethylcarbamoyl)phenyl] N-butylcarbamothioate.
| Compound Name | S-[2-(1-sulfamoylethylcarbamoyl)phenyl] N-butylcarbamothioate |
|---|---|
| PubChem CID | 88873528 |
| Molecular Formula | C14H21N3O4S2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | S-[2-(1-sulfamoylethylcarbamoyl)phenyl] N-butylcarbamothioate |
| SMILES | CCCCNC(=O)Sc1ccccc1C(=O)NC(C)S(N)(=O)=O |
| InChI | InChI=1S/C14H21N3O4S2/c1-3-4-9-16-14(19)22-12-8-6-5-7-11(12)13(18)17-10(2)23(15,20)21/h5-8,10H,3-4,9H2,1-2H3,(H,16,19)(H,17,18)(H2,15,20,21) |
| InChIKey | QJOYTHAKZNSMTN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|