C17H19ClN2O3S2 — CID 126508306
N-butyl-4-chloro-2-phenylsulfanyl-5-sulfamoylbenzamide (PubChem CID 126508306) has the molecular formula C17H19ClN2O3S2 and a molecular weight of 398.94 g/mol. Its IUPAC name is N-butyl-4-chloro-2-phenylsulfanyl-5-sulfamoylbenzamide.
| Compound Name | N-butyl-4-chloro-2-phenylsulfanyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 126508306 |
| Molecular Formula | C17H19ClN2O3S2 |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | N-butyl-4-chloro-2-phenylsulfanyl-5-sulfamoylbenzamide |
| SMILES | CCCCNC(=O)c1cc(S(N)(=O)=O)c(Cl)cc1Sc1ccccc1 |
| InChI | InChI=1S/C17H19ClN2O3S2/c1-2-3-9-20-17(21)13-10-16(25(19,22)23)14(18)11-15(13)24-12-7-5-4-6-8-12/h4-8,10-11H,2-3,9H2,1H3,(H,20,21)(H2,19,22,23) |
| InChIKey | LHVJYOYHQKRYSI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|