C11H14ClN3O5S — CID 65374407
N-butyl-2-chloro-5-nitro-3-sulfamoylbenzamide (PubChem CID 65374407) has the molecular formula C11H14ClN3O5S and a molecular weight of 335.77 g/mol. Its IUPAC name is N-butyl-2-chloro-5-nitro-3-sulfamoylbenzamide.
| Compound Name | N-butyl-2-chloro-5-nitro-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65374407 |
| Molecular Formula | C11H14ClN3O5S |
| Molecular Weight | 335.77 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | N-butyl-2-chloro-5-nitro-3-sulfamoylbenzamide |
| SMILES | CCCCNC(=O)c1cc([N+](=O)[O-])cc(S(N)(=O)=O)c1Cl |
| InChI | InChI=1S/C11H14ClN3O5S/c1-2-3-4-14-11(16)8-5-7(15(17)18)6-9(10(8)12)21(13,19)20/h5-6H,2-4H2,1H3,(H,14,16)(H2,13,19,20) |
| InChIKey | VXEPJUCNJYHPHS-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 132.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.77 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|