C11H12BrCl2NO3S — CID 65367692
5-bromo-3-(butylcarbamoyl)-2-chlorobenzenesulfonyl chloride (PubChem CID 65367692) has the molecular formula C11H12BrCl2NO3S and a molecular weight of 389.10 g/mol. Its IUPAC name is 5-bromo-3-(butylcarbamoyl)-2-chlorobenzenesulfonyl chloride.
| Compound Name | 5-bromo-3-(butylcarbamoyl)-2-chlorobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 65367692 |
| Molecular Formula | C11H12BrCl2NO3S |
| Molecular Weight | 389.10 g/mol |
| Exact Mass | 386.91 |
| IUPAC Name | 5-bromo-3-(butylcarbamoyl)-2-chlorobenzenesulfonyl chloride |
| SMILES | CCCCNC(=O)c1cc(Br)cc(S(=O)(=O)Cl)c1Cl |
| InChI | InChI=1S/C11H12BrCl2NO3S/c1-2-3-4-15-11(16)8-5-7(12)6-9(10(8)13)19(14,17)18/h5-6H,2-4H2,1H3,(H,15,16) |
| InChIKey | RNKPRFUUPWTLIX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.10 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|