C11H12ClF2NO3S — CID 65368086
3-(butylcarbamoyl)-2,4-difluorobenzenesulfonyl chloride (PubChem CID 65368086) has the molecular formula C11H12ClF2NO3S and a molecular weight of 311.74 g/mol. Its IUPAC name is 3-(butylcarbamoyl)-2,4-difluorobenzenesulfonyl chloride.
| Compound Name | 3-(butylcarbamoyl)-2,4-difluorobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 65368086 |
| Molecular Formula | C11H12ClF2NO3S |
| Molecular Weight | 311.74 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 3-(butylcarbamoyl)-2,4-difluorobenzenesulfonyl chloride |
| SMILES | CCCCNC(=O)c1c(F)ccc(S(=O)(=O)Cl)c1F |
| InChI | InChI=1S/C11H12ClF2NO3S/c1-2-3-6-15-11(16)9-7(13)4-5-8(10(9)14)19(12,17)18/h4-5H,2-3,6H2,1H3,(H,15,16) |
| InChIKey | CKZURJVQAJPYEZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.74 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|