C16H21F2NO3S — CID 122151370
3-(cyclopropylmethylsulfonyl)-2,6-difluoro-N-pentylbenzamide (PubChem CID 122151370) has the molecular formula C16H21F2NO3S and a molecular weight of 345.41 g/mol. Its IUPAC name is 3-(cyclopropylmethylsulfonyl)-2,6-difluoro-N-pentylbenzamide.
| Compound Name | 3-(cyclopropylmethylsulfonyl)-2,6-difluoro-N-pentylbenzamide |
|---|---|
| PubChem CID | 122151370 |
| Molecular Formula | C16H21F2NO3S |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 3-(cyclopropylmethylsulfonyl)-2,6-difluoro-N-pentylbenzamide |
| SMILES | CCCCCNC(=O)c1c(F)ccc(S(=O)(=O)CC2CC2)c1F |
| InChI | InChI=1S/C16H21F2NO3S/c1-2-3-4-9-19-16(20)14-12(17)7-8-13(15(14)18)23(21,22)10-11-5-6-11/h7-8,11H,2-6,9-10H2,1H3,(H,19,20) |
| InChIKey | HNSQYSFQVZPEGZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|