C18H19F2N3O3S — CID 166416665
N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3-(cyclopropylmethylsulfonyl)-2,6-difluorobenzamide (PubChem CID 166416665) has the molecular formula C18H19F2N3O3S and a molecular weight of 395.43 g/mol. Its IUPAC name is N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3-(cyclopropylmethylsulfonyl)-2,6-difluorobenzamide.
| Compound Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3-(cyclopropylmethylsulfonyl)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 166416665 |
| Molecular Formula | C18H19F2N3O3S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-3-(cyclopropylmethylsulfonyl)-2,6-difluorobenzamide |
| SMILES | C#CCCC1(CCNC(=O)c2c(F)ccc(S(=O)(=O)CC3CC3)c2F)N=N1 |
| InChI | InChI=1S/C18H19F2N3O3S/c1-2-3-8-18(22-23-18)9-10-21-17(24)15-13(19)6-7-14(16(15)20)27(25,26)11-12-4-5-12/h1,6-7,12H,3-5,8-11H2,(H,21,24) |
| InChIKey | APSPODPDHQQVJA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|