C17H18F2N4O2 — CID 166416382
N-[3-[2-(3-but-3-ynyldiazirin-3-yl)ethylamino]-3-oxopropyl]-2,4-difluorobenzamide (PubChem CID 166416382) has the molecular formula C17H18F2N4O2 and a molecular weight of 348.35 g/mol. Its IUPAC name is N-[3-[2-(3-but-3-ynyldiazirin-3-yl)ethylamino]-3-oxopropyl]-2,4-difluorobenzamide.
| Compound Name | N-[3-[2-(3-but-3-ynyldiazirin-3-yl)ethylamino]-3-oxopropyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 166416382 |
| Molecular Formula | C17H18F2N4O2 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N-[3-[2-(3-but-3-ynyldiazirin-3-yl)ethylamino]-3-oxopropyl]-2,4-difluorobenzamide |
| SMILES | C#CCCC1(CCNC(=O)CCNC(=O)c2ccc(F)cc2F)N=N1 |
| InChI | InChI=1S/C17H18F2N4O2/c1-2-3-7-17(22-23-17)8-10-20-15(24)6-9-21-16(25)13-5-4-12(18)11-14(13)19/h1,4-5,11H,3,6-10H2,(H,20,24)(H,21,25) |
| InChIKey | LQWBTJMZUJZVCO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|