C18H17ClF2N2O2 — CID 51192847
N-[3-[2-(3-chlorophenyl)ethylamino]-3-oxopropyl]-2,4-difluorobenzamide (PubChem CID 51192847) has the molecular formula C18H17ClF2N2O2 and a molecular weight of 366.80 g/mol. Its IUPAC name is N-[3-[2-(3-chlorophenyl)ethylamino]-3-oxopropyl]-2,4-difluorobenzamide.
| Compound Name | N-[3-[2-(3-chlorophenyl)ethylamino]-3-oxopropyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 51192847 |
| Molecular Formula | C18H17ClF2N2O2 |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | N-[3-[2-(3-chlorophenyl)ethylamino]-3-oxopropyl]-2,4-difluorobenzamide |
| SMILES | O=C(CCNC(=O)c1ccc(F)cc1F)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H17ClF2N2O2/c19-13-3-1-2-12(10-13)6-8-22-17(24)7-9-23-18(25)15-5-4-14(20)11-16(15)21/h1-5,10-11H,6-9H2,(H,22,24)(H,23,25) |
| InChIKey | OTWLHCRMNKSDJJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |