C21H25F2N3O2 — CID 29478462
N-[3-[3-[benzyl(methyl)amino]propylamino]-3-oxopropyl]-2,4-difluorobenzamide (PubChem CID 29478462) has the molecular formula C21H25F2N3O2 and a molecular weight of 389.45 g/mol. Its IUPAC name is N-[3-[3-[benzyl(methyl)amino]propylamino]-3-oxopropyl]-2,4-difluorobenzamide.
| Compound Name | N-[3-[3-[benzyl(methyl)amino]propylamino]-3-oxopropyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 29478462 |
| Molecular Formula | C21H25F2N3O2 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | N-[3-[3-[benzyl(methyl)amino]propylamino]-3-oxopropyl]-2,4-difluorobenzamide |
| SMILES | CN(CCCNC(=O)CCNC(=O)c1ccc(F)cc1F)Cc1ccccc1 |
| InChI | InChI=1S/C21H25F2N3O2/c1-26(15-16-6-3-2-4-7-16)13-5-11-24-20(27)10-12-25-21(28)18-9-8-17(22)14-19(18)23/h2-4,6-9,14H,5,10-13,15H2,1H3,(H,24,27)(H,25,28) |
| InChIKey | JSHUTJMTSZKVML-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|