C14H18F2N2O3 — CID 110886148
2,4-difluoro-N-[4-[2-hydroxyethyl(methyl)amino]-4-oxobutyl]benzamide (PubChem CID 110886148) has the molecular formula C14H18F2N2O3 and a molecular weight of 300.30 g/mol. Its IUPAC name is 2,4-difluoro-N-[4-[2-hydroxyethyl(methyl)amino]-4-oxobutyl]benzamide.
| Compound Name | 2,4-difluoro-N-[4-[2-hydroxyethyl(methyl)amino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 110886148 |
| Molecular Formula | C14H18F2N2O3 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2,4-difluoro-N-[4-[2-hydroxyethyl(methyl)amino]-4-oxobutyl]benzamide |
| SMILES | CN(CCO)C(=O)CCCNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H18F2N2O3/c1-18(7-8-19)13(20)3-2-6-17-14(21)11-5-4-10(15)9-12(11)16/h4-5,9,19H,2-3,6-8H2,1H3,(H,17,21) |
| InChIKey | PWWVGUCTFYGFLC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|