C14H19F2N3O4S — CID 46434276
2,4-difluoro-N-[2-[3-[methyl(methylsulfonyl)amino]propylamino]-2-oxoethyl]benzamide (PubChem CID 46434276) has the molecular formula C14H19F2N3O4S and a molecular weight of 363.39 g/mol. Its IUPAC name is 2,4-difluoro-N-[2-[3-[methyl(methylsulfonyl)amino]propylamino]-2-oxoethyl]benzamide.
| Compound Name | 2,4-difluoro-N-[2-[3-[methyl(methylsulfonyl)amino]propylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 46434276 |
| Molecular Formula | C14H19F2N3O4S |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2,4-difluoro-N-[2-[3-[methyl(methylsulfonyl)amino]propylamino]-2-oxoethyl]benzamide |
| SMILES | CN(CCCNC(=O)CNC(=O)c1ccc(F)cc1F)S(C)(=O)=O |
| InChI | InChI=1S/C14H19F2N3O4S/c1-19(24(2,22)23)7-3-6-17-13(20)9-18-14(21)11-5-4-10(15)8-12(11)16/h4-5,8H,3,6-7,9H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | FBHXRCGOFSCOAU-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|