C11H11F2NO — CID 114618824
2,4-difluoro-N-(2-methylprop-2-enyl)benzamide (PubChem CID 114618824) has the molecular formula C11H11F2NO and a molecular weight of 211.21 g/mol. Its IUPAC name is 2,4-difluoro-N-(2-methylprop-2-enyl)benzamide.
| Compound Name | 2,4-difluoro-N-(2-methylprop-2-enyl)benzamide |
|---|---|
| PubChem CID | 114618824 |
| Molecular Formula | C11H11F2NO |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2,4-difluoro-N-(2-methylprop-2-enyl)benzamide |
| SMILES | C=C(C)CNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H11F2NO/c1-7(2)6-14-11(15)9-4-3-8(12)5-10(9)13/h3-5H,1,6H2,2H3,(H,14,15) |
| InChIKey | SBAYVZGSOZJPPQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|