C11H12F2N2O2 — CID 9480520
N-[2-(dimethylamino)-2-oxoethyl]-2,4-difluorobenzamide (PubChem CID 9480520) has the molecular formula C11H12F2N2O2 and a molecular weight of 242.22 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-oxoethyl]-2,4-difluorobenzamide.
| Compound Name | N-[2-(dimethylamino)-2-oxoethyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 9480520 |
| Molecular Formula | C11H12F2N2O2 |
| Molecular Weight | 242.22 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | N-[2-(dimethylamino)-2-oxoethyl]-2,4-difluorobenzamide |
| SMILES | CN(C)C(=O)CNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H12F2N2O2/c1-15(2)10(16)6-14-11(17)8-4-3-7(12)5-9(8)13/h3-5H,6H2,1-2H3,(H,14,17) |
| InChIKey | FCISPLZOGDEHNV-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |