C12H16F2N2O2 — CID 110281414
N-[3-(dimethylamino)-2-hydroxypropyl]-2,4-difluorobenzamide (PubChem CID 110281414) has the molecular formula C12H16F2N2O2 and a molecular weight of 258.27 g/mol. Its IUPAC name is N-[3-(dimethylamino)-2-hydroxypropyl]-2,4-difluorobenzamide.
| Compound Name | N-[3-(dimethylamino)-2-hydroxypropyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 110281414 |
| Molecular Formula | C12H16F2N2O2 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | N-[3-(dimethylamino)-2-hydroxypropyl]-2,4-difluorobenzamide |
| SMILES | CN(C)CC(O)CNC(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H16F2N2O2/c1-16(2)7-9(17)6-15-12(18)10-4-3-8(13)5-11(10)14/h3-5,9,17H,6-7H2,1-2H3,(H,15,18) |
| InChIKey | APMSSWRNIUEPQK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |