C13H18ClFN2O2 — CID 125438904
2-chloro-N-[(2R)-3-(dimethylamino)-2-hydroxypropyl]-6-fluoro-3-methylbenzamide (PubChem CID 125438904) has the molecular formula C13H18ClFN2O2 and a molecular weight of 288.75 g/mol. Its IUPAC name is 2-chloro-N-[(2R)-3-(dimethylamino)-2-hydroxypropyl]-6-fluoro-3-methylbenzamide.
| Compound Name | 2-chloro-N-[(2R)-3-(dimethylamino)-2-hydroxypropyl]-6-fluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 125438904 |
| Molecular Formula | C13H18ClFN2O2 |
| Molecular Weight | 288.75 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2-chloro-N-[(2R)-3-(dimethylamino)-2-hydroxypropyl]-6-fluoro-3-methylbenzamide |
| SMILES | Cc1ccc(F)c(C(=O)NC[C@@H](O)CN(C)C)c1Cl |
| InChI | InChI=1S/C13H18ClFN2O2/c1-8-4-5-10(15)11(12(8)14)13(19)16-6-9(18)7-17(2)3/h4-5,9,18H,6-7H2,1-3H3,(H,16,19)/t9-/m1/s1 |
| InChIKey | FAGJWTBPMSYLHC-SECBINFHSA-N |
| XLogP | 1.44 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.75 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |