C10H11ClFNO3 — CID 66175370
5-chloro-N-(2,3-dihydroxypropyl)-2-fluorobenzamide (PubChem CID 66175370) has the molecular formula C10H11ClFNO3 and a molecular weight of 247.65 g/mol. Its IUPAC name is 5-chloro-N-(2,3-dihydroxypropyl)-2-fluorobenzamide.
| Compound Name | 5-chloro-N-(2,3-dihydroxypropyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 66175370 |
| Molecular Formula | C10H11ClFNO3 |
| Molecular Weight | 247.65 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 5-chloro-N-(2,3-dihydroxypropyl)-2-fluorobenzamide |
| SMILES | O=C(NCC(O)CO)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C10H11ClFNO3/c11-6-1-2-9(12)8(3-6)10(16)13-4-7(15)5-14/h1-3,7,14-15H,4-5H2,(H,13,16) |
| InChIKey | CTAHAWPGODQEFW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.65 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |