C10H10ClFN2O3 — CID 107261069
N-(3-amino-2-hydroxy-3-oxopropyl)-4-chloro-2-fluorobenzamide (PubChem CID 107261069) has the molecular formula C10H10ClFN2O3 and a molecular weight of 260.65 g/mol. Its IUPAC name is N-(3-amino-2-hydroxy-3-oxopropyl)-4-chloro-2-fluorobenzamide.
| Compound Name | N-(3-amino-2-hydroxy-3-oxopropyl)-4-chloro-2-fluorobenzamide |
|---|---|
| PubChem CID | 107261069 |
| Molecular Formula | C10H10ClFN2O3 |
| Molecular Weight | 260.65 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | N-(3-amino-2-hydroxy-3-oxopropyl)-4-chloro-2-fluorobenzamide |
| SMILES | NC(=O)C(O)CNC(=O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C10H10ClFN2O3/c11-5-1-2-6(7(12)3-5)10(17)14-4-8(15)9(13)16/h1-3,8,15H,4H2,(H2,13,16)(H,14,17) |
| InChIKey | PGSNNCMOYVHDJX-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.65 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |