C10H10ClIN2O3 — CID 107261187
N-(3-amino-2-hydroxy-3-oxopropyl)-5-chloro-2-iodobenzamide (PubChem CID 107261187) has the molecular formula C10H10ClIN2O3 and a molecular weight of 368.56 g/mol. Its IUPAC name is N-(3-amino-2-hydroxy-3-oxopropyl)-5-chloro-2-iodobenzamide.
| Compound Name | N-(3-amino-2-hydroxy-3-oxopropyl)-5-chloro-2-iodobenzamide |
|---|---|
| PubChem CID | 107261187 |
| Molecular Formula | C10H10ClIN2O3 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 367.94 |
| IUPAC Name | N-(3-amino-2-hydroxy-3-oxopropyl)-5-chloro-2-iodobenzamide |
| SMILES | NC(=O)C(O)CNC(=O)c1cc(Cl)ccc1I |
| InChI | InChI=1S/C10H10ClIN2O3/c11-5-1-2-7(12)6(3-5)10(17)14-4-8(15)9(13)16/h1-3,8,15H,4H2,(H2,13,16)(H,14,17) |
| InChIKey | XDOSLPFDLCPMCN-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|