C14H18BrClINO — CID 114168869
N-(2-bromo-3-ethylpentyl)-5-chloro-2-iodobenzamide (PubChem CID 114168869) has the molecular formula C14H18BrClINO and a molecular weight of 458.57 g/mol. Its IUPAC name is N-(2-bromo-3-ethylpentyl)-5-chloro-2-iodobenzamide.
| Compound Name | N-(2-bromo-3-ethylpentyl)-5-chloro-2-iodobenzamide |
|---|---|
| PubChem CID | 114168869 |
| Molecular Formula | C14H18BrClINO |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 456.93 |
| IUPAC Name | N-(2-bromo-3-ethylpentyl)-5-chloro-2-iodobenzamide |
| SMILES | CCC(CC)C(Br)CNC(=O)c1cc(Cl)ccc1I |
| InChI | InChI=1S/C14H18BrClINO/c1-3-9(4-2)12(15)8-18-14(19)11-7-10(16)5-6-13(11)17/h5-7,9,12H,3-4,8H2,1-2H3,(H,18,19) |
| InChIKey | IPKDSOYXPNHMMU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|