C14H17ClINO3 — CID 103791345
2-[[(5-chloro-2-iodobenzoyl)amino]methyl]-4-methylpentanoic acid (PubChem CID 103791345) has the molecular formula C14H17ClINO3 and a molecular weight of 409.65 g/mol. Its IUPAC name is 2-[[(5-chloro-2-iodobenzoyl)amino]methyl]-4-methylpentanoic acid.
| Compound Name | 2-[[(5-chloro-2-iodobenzoyl)amino]methyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 103791345 |
| Molecular Formula | C14H17ClINO3 |
| Molecular Weight | 409.65 g/mol |
| Exact Mass | 408.99 |
| IUPAC Name | 2-[[(5-chloro-2-iodobenzoyl)amino]methyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(CNC(=O)c1cc(Cl)ccc1I)C(=O)O |
| InChI | InChI=1S/C14H17ClINO3/c1-8(2)5-9(14(19)20)7-17-13(18)11-6-10(15)3-4-12(11)16/h3-4,6,8-9H,5,7H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | NRLKCUIRWZJDMI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.65 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|