C12H15ClINO2 — CID 113268309
5-chloro-N-(2-hydroxy-3-methylbutyl)-2-iodobenzamide (PubChem CID 113268309) has the molecular formula C12H15ClINO2 and a molecular weight of 367.61 g/mol. Its IUPAC name is 5-chloro-N-(2-hydroxy-3-methylbutyl)-2-iodobenzamide.
| Compound Name | 5-chloro-N-(2-hydroxy-3-methylbutyl)-2-iodobenzamide |
|---|---|
| PubChem CID | 113268309 |
| Molecular Formula | C12H15ClINO2 |
| Molecular Weight | 367.61 g/mol |
| Exact Mass | 366.98 |
| IUPAC Name | 5-chloro-N-(2-hydroxy-3-methylbutyl)-2-iodobenzamide |
| SMILES | CC(C)C(O)CNC(=O)c1cc(Cl)ccc1I |
| InChI | InChI=1S/C12H15ClINO2/c1-7(2)11(16)6-15-12(17)9-5-8(13)3-4-10(9)14/h3-5,7,11,16H,6H2,1-2H3,(H,15,17) |
| InChIKey | GTLKYYWKZAAAKE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.61 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|