C10H11IN2O4 — CID 106164507
N-(3-amino-2-hydroxy-3-oxopropyl)-3-hydroxy-4-iodobenzamide (PubChem CID 106164507) has the molecular formula C10H11IN2O4 and a molecular weight of 350.11 g/mol. Its IUPAC name is N-(3-amino-2-hydroxy-3-oxopropyl)-3-hydroxy-4-iodobenzamide.
| Compound Name | N-(3-amino-2-hydroxy-3-oxopropyl)-3-hydroxy-4-iodobenzamide |
|---|---|
| PubChem CID | 106164507 |
| Molecular Formula | C10H11IN2O4 |
| Molecular Weight | 350.11 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | N-(3-amino-2-hydroxy-3-oxopropyl)-3-hydroxy-4-iodobenzamide |
| SMILES | NC(=O)C(O)CNC(=O)c1ccc(I)c(O)c1 |
| InChI | InChI=1S/C10H11IN2O4/c11-6-2-1-5(3-7(6)14)10(17)13-4-8(15)9(12)16/h1-3,8,14-15H,4H2,(H2,12,16)(H,13,17) |
| InChIKey | GNJSCDRUUAUKGC-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.11 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|