C12H14INO2 — CID 104628967
N-(2-cyclopropylethyl)-3-hydroxy-4-iodobenzamide (PubChem CID 104628967) has the molecular formula C12H14INO2 and a molecular weight of 331.15 g/mol. Its IUPAC name is N-(2-cyclopropylethyl)-3-hydroxy-4-iodobenzamide.
| Compound Name | N-(2-cyclopropylethyl)-3-hydroxy-4-iodobenzamide |
|---|---|
| PubChem CID | 104628967 |
| Molecular Formula | C12H14INO2 |
| Molecular Weight | 331.15 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | N-(2-cyclopropylethyl)-3-hydroxy-4-iodobenzamide |
| SMILES | O=C(NCCC1CC1)c1ccc(I)c(O)c1 |
| InChI | InChI=1S/C12H14INO2/c13-10-4-3-9(7-11(10)15)12(16)14-6-5-8-1-2-8/h3-4,7-8,15H,1-2,5-6H2,(H,14,16) |
| InChIKey | HJGFNATYEITHQV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.15 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|