C10H9F3INO2S — CID 104627726
3-hydroxy-4-iodo-N-[2-(trifluoromethylsulfanyl)ethyl]benzamide (PubChem CID 104627726) has the molecular formula C10H9F3INO2S and a molecular weight of 391.15 g/mol. Its IUPAC name is 3-hydroxy-4-iodo-N-[2-(trifluoromethylsulfanyl)ethyl]benzamide.
| Compound Name | 3-hydroxy-4-iodo-N-[2-(trifluoromethylsulfanyl)ethyl]benzamide |
|---|---|
| PubChem CID | 104627726 |
| Molecular Formula | C10H9F3INO2S |
| Molecular Weight | 391.15 g/mol |
| Exact Mass | 390.94 |
| IUPAC Name | 3-hydroxy-4-iodo-N-[2-(trifluoromethylsulfanyl)ethyl]benzamide |
| SMILES | O=C(NCCSC(F)(F)F)c1ccc(I)c(O)c1 |
| InChI | InChI=1S/C10H9F3INO2S/c11-10(12,13)18-4-3-15-9(17)6-1-2-7(14)8(16)5-6/h1-2,5,16H,3-4H2,(H,15,17) |
| InChIKey | CEFPHHKAKQFVNT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.15 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|