C9H8F2INO5S — CID 167388367
1,1-difluoro-2-[(3-hydroxy-4-iodobenzoyl)amino]ethanesulfonic acid (PubChem CID 167388367) has the molecular formula C9H8F2INO5S and a molecular weight of 407.13 g/mol. Its IUPAC name is 1,1-difluoro-2-[(3-hydroxy-4-iodobenzoyl)amino]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[(3-hydroxy-4-iodobenzoyl)amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 167388367 |
| Molecular Formula | C9H8F2INO5S |
| Molecular Weight | 407.13 g/mol |
| Exact Mass | 406.91 |
| IUPAC Name | 1,1-difluoro-2-[(3-hydroxy-4-iodobenzoyl)amino]ethanesulfonic acid |
| SMILES | O=C(NCC(F)(F)S(=O)(=O)O)c1ccc(I)c(O)c1 |
| InChI | InChI=1S/C9H8F2INO5S/c10-9(11,19(16,17)18)4-13-8(15)5-1-2-6(12)7(14)3-5/h1-3,14H,4H2,(H,13,15)(H,16,17,18) |
| InChIKey | LBZMLPHSJBIATR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.13 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|