C9H7ClF2INO4S — CID 167388360
2-[(2-chloro-5-iodobenzoyl)amino]-1,1-difluoroethanesulfonic acid (PubChem CID 167388360) has the molecular formula C9H7ClF2INO4S and a molecular weight of 425.58 g/mol. Its IUPAC name is 2-[(2-chloro-5-iodobenzoyl)amino]-1,1-difluoroethanesulfonic acid.
| Compound Name | 2-[(2-chloro-5-iodobenzoyl)amino]-1,1-difluoroethanesulfonic acid |
|---|---|
| PubChem CID | 167388360 |
| Molecular Formula | C9H7ClF2INO4S |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 424.88 |
| IUPAC Name | 2-[(2-chloro-5-iodobenzoyl)amino]-1,1-difluoroethanesulfonic acid |
| SMILES | O=C(NCC(F)(F)S(=O)(=O)O)c1cc(I)ccc1Cl |
| InChI | InChI=1S/C9H7ClF2INO4S/c10-7-2-1-5(13)3-6(7)8(15)14-4-9(11,12)19(16,17)18/h1-3H,4H2,(H,14,15)(H,16,17,18) |
| InChIKey | RAIWQEPRISGKNF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|