C10H9ClF3NOS — CID 78780256
2-chloro-5-methylsulfanyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 78780256) has the molecular formula C10H9ClF3NOS and a molecular weight of 283.70 g/mol. Its IUPAC name is 2-chloro-5-methylsulfanyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-chloro-5-methylsulfanyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 78780256 |
| Molecular Formula | C10H9ClF3NOS |
| Molecular Weight | 283.70 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | 2-chloro-5-methylsulfanyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | CSc1ccc(Cl)c(C(=O)NCC(F)(F)F)c1 |
| InChI | InChI=1S/C10H9ClF3NOS/c1-17-6-2-3-8(11)7(4-6)9(16)15-5-10(12,13)14/h2-4H,5H2,1H3,(H,15,16) |
| InChIKey | KHPPOWQRRBDGAM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.70 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |