C14H20ClNOS — CID 115612538
2-chloro-N-(2-ethylbutyl)-5-methylsulfanylbenzamide (PubChem CID 115612538) has the molecular formula C14H20ClNOS and a molecular weight of 285.84 g/mol. Its IUPAC name is 2-chloro-N-(2-ethylbutyl)-5-methylsulfanylbenzamide.
| Compound Name | 2-chloro-N-(2-ethylbutyl)-5-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 115612538 |
| Molecular Formula | C14H20ClNOS |
| Molecular Weight | 285.84 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-chloro-N-(2-ethylbutyl)-5-methylsulfanylbenzamide |
| SMILES | CCC(CC)CNC(=O)c1cc(SC)ccc1Cl |
| InChI | InChI=1S/C14H20ClNOS/c1-4-10(5-2)9-16-14(17)12-8-11(18-3)6-7-13(12)15/h6-8,10H,4-5,9H2,1-3H3,(H,16,17) |
| InChIKey | IBPBYWFNGRORIK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.84 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |