C13H18ClNO2S — CID 107319089
2-chloro-N-(5-hydroxypentyl)-5-methylsulfanylbenzamide (PubChem CID 107319089) has the molecular formula C13H18ClNO2S and a molecular weight of 287.81 g/mol. Its IUPAC name is 2-chloro-N-(5-hydroxypentyl)-5-methylsulfanylbenzamide.
| Compound Name | 2-chloro-N-(5-hydroxypentyl)-5-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 107319089 |
| Molecular Formula | C13H18ClNO2S |
| Molecular Weight | 287.81 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 2-chloro-N-(5-hydroxypentyl)-5-methylsulfanylbenzamide |
| SMILES | CSc1ccc(Cl)c(C(=O)NCCCCCO)c1 |
| InChI | InChI=1S/C13H18ClNO2S/c1-18-10-5-6-12(14)11(9-10)13(17)15-7-3-2-4-8-16/h5-6,9,16H,2-4,7-8H2,1H3,(H,15,17) |
| InChIKey | VTJLLIBNEUAIFI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.81 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|