C13H16ClNOS — CID 113236475
2-chloro-5-methylsulfanyl-N-[(E)-pent-3-enyl]benzamide (PubChem CID 113236475) has the molecular formula C13H16ClNOS and a molecular weight of 269.80 g/mol. Its IUPAC name is 2-chloro-5-methylsulfanyl-N-[(E)-pent-3-enyl]benzamide.
| Compound Name | 2-chloro-5-methylsulfanyl-N-[(E)-pent-3-enyl]benzamide |
|---|---|
| PubChem CID | 113236475 |
| Molecular Formula | C13H16ClNOS |
| Molecular Weight | 269.80 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 2-chloro-5-methylsulfanyl-N-[(E)-pent-3-enyl]benzamide |
| SMILES | C/C=C/CCNC(=O)c1cc(SC)ccc1Cl |
| InChI | InChI=1S/C13H16ClNOS/c1-3-4-5-8-15-13(16)11-9-10(17-2)6-7-12(11)14/h3-4,6-7,9H,5,8H2,1-2H3,(H,15,16)/b4-3+ |
| InChIKey | HHFVVLQTMJFGPE-ONEGZZNKSA-N |
| XLogP | 3.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.80 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|