C12H12ClF2NO — CID 115868338
4-chloro-2,5-difluoro-N-[(E)-pent-3-enyl]benzamide (PubChem CID 115868338) has the molecular formula C12H12ClF2NO and a molecular weight of 259.68 g/mol. Its IUPAC name is 4-chloro-2,5-difluoro-N-[(E)-pent-3-enyl]benzamide.
| Compound Name | 4-chloro-2,5-difluoro-N-[(E)-pent-3-enyl]benzamide |
|---|---|
| PubChem CID | 115868338 |
| Molecular Formula | C12H12ClF2NO |
| Molecular Weight | 259.68 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 4-chloro-2,5-difluoro-N-[(E)-pent-3-enyl]benzamide |
| SMILES | C/C=C/CCNC(=O)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C12H12ClF2NO/c1-2-3-4-5-16-12(17)8-6-11(15)9(13)7-10(8)14/h2-3,6-7H,4-5H2,1H3,(H,16,17)/b3-2+ |
| InChIKey | SNSJFPPPGIEXNY-NSCUHMNNSA-N |
| XLogP | 3.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.68 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|