C11H13ClF2N2O — CID 82783569
N-(4-aminobutyl)-4-chloro-2,5-difluorobenzamide (PubChem CID 82783569) has the molecular formula C11H13ClF2N2O and a molecular weight of 262.69 g/mol. Its IUPAC name is N-(4-aminobutyl)-4-chloro-2,5-difluorobenzamide.
| Compound Name | N-(4-aminobutyl)-4-chloro-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 82783569 |
| Molecular Formula | C11H13ClF2N2O |
| Molecular Weight | 262.69 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | N-(4-aminobutyl)-4-chloro-2,5-difluorobenzamide |
| SMILES | NCCCCNC(=O)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C11H13ClF2N2O/c12-8-6-9(13)7(5-10(8)14)11(17)16-4-2-1-3-15/h5-6H,1-4,15H2,(H,16,17) |
| InChIKey | AIXAYJSFKZHXQD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.69 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|