C11H11ClF2N4O — CID 106386799
N-(4-azidobutyl)-4-chloro-2,5-difluorobenzamide (PubChem CID 106386799) has the molecular formula C11H11ClF2N4O and a molecular weight of 288.69 g/mol. Its IUPAC name is N-(4-azidobutyl)-4-chloro-2,5-difluorobenzamide.
| Compound Name | N-(4-azidobutyl)-4-chloro-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 106386799 |
| Molecular Formula | C11H11ClF2N4O |
| Molecular Weight | 288.69 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | N-(4-azidobutyl)-4-chloro-2,5-difluorobenzamide |
| SMILES | [N-]=[N+]=NCCCCNC(=O)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C11H11ClF2N4O/c12-8-6-9(13)7(5-10(8)14)11(19)16-3-1-2-4-17-18-15/h5-6H,1-4H2,(H,16,19) |
| InChIKey | CWKHGHGETJHCLN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.69 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|