C11H12F2N4O — CID 106386485
N-(4-azidobutyl)-3,4-difluorobenzamide (PubChem CID 106386485) has the molecular formula C11H12F2N4O and a molecular weight of 254.24 g/mol. Its IUPAC name is N-(4-azidobutyl)-3,4-difluorobenzamide.
| Compound Name | N-(4-azidobutyl)-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 106386485 |
| Molecular Formula | C11H12F2N4O |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | N-(4-azidobutyl)-3,4-difluorobenzamide |
| SMILES | [N-]=[N+]=NCCCCNC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H12F2N4O/c12-9-4-3-8(7-10(9)13)11(18)15-5-1-2-6-16-17-14/h3-4,7H,1-2,5-6H2,(H,15,18) |
| InChIKey | OBPUTOFDUYEMNL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|