C11H14N4O3 — CID 106386706
N-(4-azidobutyl)-3,4-dihydroxybenzamide (PubChem CID 106386706) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is N-(4-azidobutyl)-3,4-dihydroxybenzamide.
| Compound Name | N-(4-azidobutyl)-3,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 106386706 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | N-(4-azidobutyl)-3,4-dihydroxybenzamide |
| SMILES | [N-]=[N+]=NCCCCNC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H14N4O3/c12-15-14-6-2-1-5-13-11(18)8-3-4-9(16)10(17)7-8/h3-4,7,16-17H,1-2,5-6H2,(H,13,18) |
| InChIKey | LDPVCFQJFSRZRK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 118.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|