C12H16N4O3 — CID 61344006
N-(3-azidopropyl)-3,4-dimethoxybenzamide (PubChem CID 61344006) has the molecular formula C12H16N4O3 and a molecular weight of 264.29 g/mol. Its IUPAC name is N-(3-azidopropyl)-3,4-dimethoxybenzamide.
| Compound Name | N-(3-azidopropyl)-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 61344006 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | N-(3-azidopropyl)-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCCN=[N+]=[N-])cc1OC |
| InChI | InChI=1S/C12H16N4O3/c1-18-10-5-4-9(8-11(10)19-2)12(17)14-6-3-7-15-16-13/h4-5,8H,3,6-7H2,1-2H3,(H,14,17) |
| InChIKey | VUFMHBFIOWQHMX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|