C12H14F2N4O — CID 106386362
N-(4-azidobutyl)-2,6-difluoro-3-methylbenzamide (PubChem CID 106386362) has the molecular formula C12H14F2N4O and a molecular weight of 268.27 g/mol. Its IUPAC name is N-(4-azidobutyl)-2,6-difluoro-3-methylbenzamide.
| Compound Name | N-(4-azidobutyl)-2,6-difluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 106386362 |
| Molecular Formula | C12H14F2N4O |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | N-(4-azidobutyl)-2,6-difluoro-3-methylbenzamide |
| SMILES | Cc1ccc(F)c(C(=O)NCCCCN=[N+]=[N-])c1F |
| InChI | InChI=1S/C12H14F2N4O/c1-8-4-5-9(13)10(11(8)14)12(19)16-6-2-3-7-17-18-15/h4-5H,2-3,6-7H2,1H3,(H,16,19) |
| InChIKey | KZYXBHYYUNPOOU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|