C10H9ClF2N2O3 — CID 106165772
N-(3-amino-2-hydroxy-3-oxopropyl)-4-chloro-2,5-difluorobenzamide (PubChem CID 106165772) has the molecular formula C10H9ClF2N2O3 and a molecular weight of 278.64 g/mol. Its IUPAC name is N-(3-amino-2-hydroxy-3-oxopropyl)-4-chloro-2,5-difluorobenzamide.
| Compound Name | N-(3-amino-2-hydroxy-3-oxopropyl)-4-chloro-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 106165772 |
| Molecular Formula | C10H9ClF2N2O3 |
| Molecular Weight | 278.64 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | N-(3-amino-2-hydroxy-3-oxopropyl)-4-chloro-2,5-difluorobenzamide |
| SMILES | NC(=O)C(O)CNC(=O)c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C10H9ClF2N2O3/c11-5-2-6(12)4(1-7(5)13)10(18)15-3-8(16)9(14)17/h1-2,8,16H,3H2,(H2,14,17)(H,15,18) |
| InChIKey | JLHIMVKWMYKFMU-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.64 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|