C10H11F2N3O3 — CID 114152397
2-amino-N-(3-amino-2-hydroxy-3-oxopropyl)-4,5-difluorobenzamide (PubChem CID 114152397) has the molecular formula C10H11F2N3O3 and a molecular weight of 259.21 g/mol. Its IUPAC name is 2-amino-N-(3-amino-2-hydroxy-3-oxopropyl)-4,5-difluorobenzamide.
| Compound Name | 2-amino-N-(3-amino-2-hydroxy-3-oxopropyl)-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 114152397 |
| Molecular Formula | C10H11F2N3O3 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 2-amino-N-(3-amino-2-hydroxy-3-oxopropyl)-4,5-difluorobenzamide |
| SMILES | NC(=O)C(O)CNC(=O)c1cc(F)c(F)cc1N |
| InChI | InChI=1S/C10H11F2N3O3/c11-5-1-4(7(13)2-6(5)12)10(18)15-3-8(16)9(14)17/h1-2,8,16H,3,13H2,(H2,14,17)(H,15,18) |
| InChIKey | OWIKCNJYUSFTTM-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|