C11H13FN2O3 — CID 107261331
N-(3-amino-2-hydroxy-3-oxopropyl)-5-fluoro-2-methylbenzamide (PubChem CID 107261331) has the molecular formula C11H13FN2O3 and a molecular weight of 240.23 g/mol. Its IUPAC name is N-(3-amino-2-hydroxy-3-oxopropyl)-5-fluoro-2-methylbenzamide.
| Compound Name | N-(3-amino-2-hydroxy-3-oxopropyl)-5-fluoro-2-methylbenzamide |
|---|---|
| PubChem CID | 107261331 |
| Molecular Formula | C11H13FN2O3 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | N-(3-amino-2-hydroxy-3-oxopropyl)-5-fluoro-2-methylbenzamide |
| SMILES | Cc1ccc(F)cc1C(=O)NCC(O)C(N)=O |
| InChI | InChI=1S/C11H13FN2O3/c1-6-2-3-7(12)4-8(6)11(17)14-5-9(15)10(13)16/h2-4,9,15H,5H2,1H3,(H2,13,16)(H,14,17) |
| InChIKey | XJTYRLBWEYOYTG-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |