C7H6F2N2O — CID 16640510
2-amino-4,5-difluorobenzamide (PubChem CID 16640510) has the molecular formula C7H6F2N2O and a molecular weight of 172.13 g/mol. Its IUPAC name is 2-amino-4,5-difluorobenzamide.
| Compound Name | 2-amino-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 16640510 |
| Molecular Formula | C7H6F2N2O |
| Molecular Weight | 172.13 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 2-amino-4,5-difluorobenzamide |
| SMILES | NC(=O)c1cc(F)c(F)cc1N |
| InChI | InChI=1S/C7H6F2N2O/c8-4-1-3(7(11)12)6(10)2-5(4)9/h1-2H,10H2,(H2,11,12) |
| InChIKey | JFMDZCSBKULXCB-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.13 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|