C13H6ClF4NO — CID 107477775
(2-amino-4,5-difluorophenyl)-(2-chloro-4,5-difluorophenyl)methanone (PubChem CID 107477775) has the molecular formula C13H6ClF4NO and a molecular weight of 303.64 g/mol. Its IUPAC name is (2-amino-4,5-difluorophenyl)-(2-chloro-4,5-difluorophenyl)methanone.
| Compound Name | (2-amino-4,5-difluorophenyl)-(2-chloro-4,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 107477775 |
| Molecular Formula | C13H6ClF4NO |
| Molecular Weight | 303.64 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | (2-amino-4,5-difluorophenyl)-(2-chloro-4,5-difluorophenyl)methanone |
| SMILES | Nc1cc(F)c(F)cc1C(=O)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C13H6ClF4NO/c14-7-3-10(17)8(15)1-5(7)13(20)6-2-9(16)11(18)4-12(6)19/h1-4H,19H2 |
| InChIKey | WFNLFGWBWIXSMK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.64 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|