C13H4Cl2F4O — CID 107475698
(2-chloro-4,5-difluorophenyl)-(4-chloro-2,5-difluorophenyl)methanone (PubChem CID 107475698) has the molecular formula C13H4Cl2F4O and a molecular weight of 323.07 g/mol. Its IUPAC name is (2-chloro-4,5-difluorophenyl)-(4-chloro-2,5-difluorophenyl)methanone.
| Compound Name | (2-chloro-4,5-difluorophenyl)-(4-chloro-2,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 107475698 |
| Molecular Formula | C13H4Cl2F4O |
| Molecular Weight | 323.07 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | (2-chloro-4,5-difluorophenyl)-(4-chloro-2,5-difluorophenyl)methanone |
| SMILES | O=C(c1cc(F)c(Cl)cc1F)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C13H4Cl2F4O/c14-7-3-12(19)11(18)1-5(7)13(20)6-2-10(17)8(15)4-9(6)16/h1-4H |
| InChIKey | ONCHNSWIHJRZKL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.07 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|